C14H18O6 — CID 171897684
4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-methylbenzoic acid (PubChem CID 171897684) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-methylbenzoic acid.
| Compound Name | 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 171897684 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-methylbenzoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H18O6/c1-3-20-12(16)7-11(15)13(17)9-4-5-10(14(18)19)8(2)6-9/h4-6,11,13,15,17H,3,7H2,1-2H3,(H,18,19) |
| InChIKey | KRSBAKGMYMFTQH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |