C11H11ClF2O4 — CID 171894377
4-(4-chloro-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid (PubChem CID 171894377) has the molecular formula C11H11ClF2O4 and a molecular weight of 280.65 g/mol. Its IUPAC name is 4-(4-chloro-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid.
| Compound Name | 4-(4-chloro-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 171894377 |
| Molecular Formula | C11H11ClF2O4 |
| Molecular Weight | 280.65 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-(4-chloro-1,2-dihydroxybutyl)-2,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(C(O)C(O)CCCl)cc1F |
| InChI | InChI=1S/C11H11ClF2O4/c12-2-1-9(15)10(16)5-3-8(14)6(11(17)18)4-7(5)13/h3-4,9-10,15-16H,1-2H2,(H,17,18) |
| InChIKey | HKRXOUNRFHJTIH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.65 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|