C10H9BrF2O4 — CID 171860563
2-(3-bromo-1,2-dihydroxypropyl)-4,5-difluorobenzoic acid (PubChem CID 171860563) has the molecular formula C10H9BrF2O4 and a molecular weight of 311.08 g/mol. Its IUPAC name is 2-(3-bromo-1,2-dihydroxypropyl)-4,5-difluorobenzoic acid.
| Compound Name | 2-(3-bromo-1,2-dihydroxypropyl)-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 171860563 |
| Molecular Formula | C10H9BrF2O4 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2-(3-bromo-1,2-dihydroxypropyl)-4,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1C(O)C(O)CBr |
| InChI | InChI=1S/C10H9BrF2O4/c11-3-8(14)9(15)4-1-6(12)7(13)2-5(4)10(16)17/h1-2,8-9,14-15H,3H2,(H,16,17) |
| InChIKey | XBHOTCWVVHPMBJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|