5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid

C10H11ClO4S — CID 170820156

IUPAC5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid
SMILESO=C(O)c1cc(Cl)ccc1C(O)C(O)CS
InChIInChI=1S/C10H11ClO4S/c11-5-1-2-6(7(3-5)10(14)15)9(13)8(12)4-16/h1-3,8-9,12-13,16H,4H2,(H,14,15)
InChIKeyBRALFJMEXUCHDJ-UHFFFAOYSA-N
MW262.71 g/mol
LogP1.36
Rot. Bonds4

About 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid

5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid (PubChem CID 170820156) has the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. Its IUPAC name is 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid.

Molecular Properties

Compound Name5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid
PubChem CID170820156
Molecular FormulaC10H11ClO4S
Molecular Weight262.71 g/mol
Exact Mass262.01
IUPAC Name5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid
SMILESO=C(O)c1cc(Cl)ccc1C(O)C(O)CS
InChIInChI=1S/C10H11ClO4S/c11-5-1-2-6(7(3-5)10(14)15)9(13)8(12)4-16/h1-3,8-9,12-13,16H,4H2,(H,14,15)
InChIKeyBRALFJMEXUCHDJ-UHFFFAOYSA-N
XLogP1.36
TPSA77.76 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.71
LogP ≤ 51.36
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
The IUPAC name of 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid (CID 170820156) is 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid.
What is the SMILES notation for 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
The canonical SMILES for 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid is O=C(O)c1cc(Cl)ccc1C(O)C(O)CS.
What is the InChIKey of 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
The InChIKey is BRALFJMEXUCHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO4S/c11-5-1-2-6(7(3-5)10(14)15)9(13)8(12)4-16/h1-3,8-9,12-13,16H,4H2,(H,14,15).
What are the key properties of 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid has a molecular weight of 262.71 g/mol, XLogP of 1.36, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid is sourced from PubChem (CID 170820156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).