C10H11ClO4S — CID 170820156
5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid (PubChem CID 170820156) has the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. Its IUPAC name is 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid.
| Compound Name | 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid |
|---|---|
| PubChem CID | 170820156 |
| Molecular Formula | C10H11ClO4S |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 5-chloro-2-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1C(O)C(O)CS |
| InChI | InChI=1S/C10H11ClO4S/c11-5-1-2-6(7(3-5)10(14)15)9(13)8(12)4-16/h1-3,8-9,12-13,16H,4H2,(H,14,15) |
| InChIKey | BRALFJMEXUCHDJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|