C11H11F3O4S — CID 170820821
2-(1,2-dihydroxy-3-sulfanylpropyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 170820821) has the molecular formula C11H11F3O4S and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170820821 |
| Molecular Formula | C11H11F3O4S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1C(O)C(O)CS |
| InChI | InChI=1S/C11H11F3O4S/c12-11(13,14)5-1-2-6(7(3-5)10(17)18)9(16)8(15)4-19/h1-3,8-9,15-16,19H,4H2,(H,17,18) |
| InChIKey | DKYXLUUAKDFXEG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|