C10H10F3NO4S — CID 170820839
1-[2-nitro-4-(trifluoromethyl)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170820839) has the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820839 |
| Molecular Formula | C10H10F3NO4S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1C(O)C(O)CS |
| InChI | InChI=1S/C10H10F3NO4S/c11-10(12,13)5-1-2-6(7(3-5)14(17)18)9(16)8(15)4-19/h1-3,8-9,15-16,19H,4H2 |
| InChIKey | GTDWCFAOLBIVEV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|