C11H11BrF3NO4 — CID 171892972
4-bromo-1-[2-nitro-4-(trifluoromethyl)phenyl]butane-1,2-diol (PubChem CID 171892972) has the molecular formula C11H11BrF3NO4 and a molecular weight of 358.11 g/mol. Its IUPAC name is 4-bromo-1-[2-nitro-4-(trifluoromethyl)phenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[2-nitro-4-(trifluoromethyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892972 |
| Molecular Formula | C11H11BrF3NO4 |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-bromo-1-[2-nitro-4-(trifluoromethyl)phenyl]butane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1C(O)C(O)CCBr |
| InChI | InChI=1S/C11H11BrF3NO4/c12-4-3-9(17)10(18)7-2-1-6(11(13,14)15)5-8(7)16(19)20/h1-2,5,9-10,17-18H,3-4H2 |
| InChIKey | SAOWEMNOANFCON-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|