C11H11BrF4O2 — CID 171892533
4-bromo-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,2-diol (PubChem CID 171892533) has the molecular formula C11H11BrF4O2 and a molecular weight of 331.10 g/mol. Its IUPAC name is 4-bromo-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892533 |
| Molecular Formula | C11H11BrF4O2 |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 4-bromo-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H11BrF4O2/c12-4-3-9(17)10(18)7-5-6(11(14,15)16)1-2-8(7)13/h1-2,5,9-10,17-18H,3-4H2 |
| InChIKey | MHUOFWXYWJRSEQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|