C11H13BrF2O2 — CID 171891860
4-bromo-1-(3,4-difluoro-2-methylphenyl)butane-1,2-diol (PubChem CID 171891860) has the molecular formula C11H13BrF2O2 and a molecular weight of 295.12 g/mol. Its IUPAC name is 4-bromo-1-(3,4-difluoro-2-methylphenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(3,4-difluoro-2-methylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891860 |
| Molecular Formula | C11H13BrF2O2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-bromo-1-(3,4-difluoro-2-methylphenyl)butane-1,2-diol |
| SMILES | Cc1c(C(O)C(O)CCBr)ccc(F)c1F |
| InChI | InChI=1S/C11H13BrF2O2/c1-6-7(2-3-8(13)10(6)14)11(16)9(15)4-5-12/h2-3,9,11,15-16H,4-5H2,1H3 |
| InChIKey | FOUFHKUPLUIMPW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|