C12H16BrFO3 — CID 171892326
4-bromo-1-(4-ethoxy-2-fluorophenyl)butane-1,2-diol (PubChem CID 171892326) has the molecular formula C12H16BrFO3 and a molecular weight of 307.16 g/mol. Its IUPAC name is 4-bromo-1-(4-ethoxy-2-fluorophenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(4-ethoxy-2-fluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171892326 |
| Molecular Formula | C12H16BrFO3 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-bromo-1-(4-ethoxy-2-fluorophenyl)butane-1,2-diol |
| SMILES | CCOc1ccc(C(O)C(O)CCBr)c(F)c1 |
| InChI | InChI=1S/C12H16BrFO3/c1-2-17-8-3-4-9(10(14)7-8)12(16)11(15)5-6-13/h3-4,7,11-12,15-16H,2,5-6H2,1H3 |
| InChIKey | HGBKUMPACXIEOG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|