C11H13F4NO3 — CID 171882137
4-amino-1-[2-fluoro-4-(trifluoromethoxy)phenyl]butane-1,2-diol (PubChem CID 171882137) has the molecular formula C11H13F4NO3 and a molecular weight of 283.22 g/mol. Its IUPAC name is 4-amino-1-[2-fluoro-4-(trifluoromethoxy)phenyl]butane-1,2-diol.
| Compound Name | 4-amino-1-[2-fluoro-4-(trifluoromethoxy)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171882137 |
| Molecular Formula | C11H13F4NO3 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-amino-1-[2-fluoro-4-(trifluoromethoxy)phenyl]butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(OC(F)(F)F)cc1F |
| InChI | InChI=1S/C11H13F4NO3/c12-8-5-6(19-11(13,14)15)1-2-7(8)10(18)9(17)3-4-16/h1-2,5,9-10,17-18H,3-4,16H2 |
| InChIKey | AGNCNFGPBGSDCX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |