C10H11ClF3NO3 — CID 170828895
3-amino-1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2-diol (PubChem CID 170828895) has the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. Its IUPAC name is 3-amino-1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170828895 |
| Molecular Formula | C10H11ClF3NO3 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-amino-1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2-diol |
| SMILES | NCC(O)C(O)c1ccc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3NO3/c11-7-3-5(18-10(12,13)14)1-2-6(7)9(17)8(16)4-15/h1-3,8-9,16-17H,4,15H2 |
| InChIKey | FMMZPKCZWPPYTK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |