C10H11ClF3NO3 — CID 171862958
1-[2-amino-4-(trifluoromethoxy)phenyl]-3-chloropropane-1,2-diol (PubChem CID 171862958) has the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. Its IUPAC name is 1-[2-amino-4-(trifluoromethoxy)phenyl]-3-chloropropane-1,2-diol.
| Compound Name | 1-[2-amino-4-(trifluoromethoxy)phenyl]-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171862958 |
| Molecular Formula | C10H11ClF3NO3 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-[2-amino-4-(trifluoromethoxy)phenyl]-3-chloropropane-1,2-diol |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(O)C(O)CCl |
| InChI | InChI=1S/C10H11ClF3NO3/c11-4-8(16)9(17)6-2-1-5(3-7(6)15)18-10(12,13)14/h1-3,8-9,16-17H,4,15H2 |
| InChIKey | JXJBJHHDOWLRSU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|