C11H13BrF3NO3 — CID 171892933
1-[2-amino-5-(trifluoromethoxy)phenyl]-4-bromobutane-1,2-diol (PubChem CID 171892933) has the molecular formula C11H13BrF3NO3 and a molecular weight of 344.13 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethoxy)phenyl]-4-bromobutane-1,2-diol.
| Compound Name | 1-[2-amino-5-(trifluoromethoxy)phenyl]-4-bromobutane-1,2-diol |
|---|---|
| PubChem CID | 171892933 |
| Molecular Formula | C11H13BrF3NO3 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethoxy)phenyl]-4-bromobutane-1,2-diol |
| SMILES | Nc1ccc(OC(F)(F)F)cc1C(O)C(O)CCBr |
| InChI | InChI=1S/C11H13BrF3NO3/c12-4-3-9(17)10(18)7-5-6(1-2-8(7)16)19-11(13,14)15/h1-2,5,9-10,17-18H,3-4,16H2 |
| InChIKey | LBUVOBAOZACTMF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|