C11H12BrF3O4 — CID 171892862
4-bromo-1-[5-hydroxy-2-(trifluoromethoxy)phenyl]butane-1,2-diol (PubChem CID 171892862) has the molecular formula C11H12BrF3O4 and a molecular weight of 345.11 g/mol. Its IUPAC name is 4-bromo-1-[5-hydroxy-2-(trifluoromethoxy)phenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[5-hydroxy-2-(trifluoromethoxy)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892862 |
| Molecular Formula | C11H12BrF3O4 |
| Molecular Weight | 345.11 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 4-bromo-1-[5-hydroxy-2-(trifluoromethoxy)phenyl]butane-1,2-diol |
| SMILES | Oc1ccc(OC(F)(F)F)c(C(O)C(O)CCBr)c1 |
| InChI | InChI=1S/C11H12BrF3O4/c12-4-3-8(17)10(18)7-5-6(16)1-2-9(7)19-11(13,14)15/h1-2,5,8,10,16-18H,3-4H2 |
| InChIKey | RPRKTHYIUDEJMO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.11 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|