C12H13F3O5S — CID 170822787
S-[2,3-dihydroxy-3-[5-hydroxy-2-(trifluoromethoxy)phenyl]propyl] ethanethioate (PubChem CID 170822787) has the molecular formula C12H13F3O5S and a molecular weight of 326.29 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-[5-hydroxy-2-(trifluoromethoxy)phenyl]propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-[5-hydroxy-2-(trifluoromethoxy)phenyl]propyl] ethanethioate |
|---|---|
| PubChem CID | 170822787 |
| Molecular Formula | C12H13F3O5S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | S-[2,3-dihydroxy-3-[5-hydroxy-2-(trifluoromethoxy)phenyl]propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H13F3O5S/c1-6(16)21-5-9(18)11(19)8-4-7(17)2-3-10(8)20-12(13,14)15/h2-4,9,11,17-19H,5H2,1H3 |
| InChIKey | GUTCGWQFQMHUJL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|