C12H12ClF3O3S — CID 170823080
S-[3-[2-chloro-4-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170823080) has the molecular formula C12H12ClF3O3S and a molecular weight of 328.74 g/mol. Its IUPAC name is S-[3-[2-chloro-4-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-[2-chloro-4-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170823080 |
| Molecular Formula | C12H12ClF3O3S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | S-[3-[2-chloro-4-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H12ClF3O3S/c1-6(17)20-5-10(18)11(19)8-3-2-7(4-9(8)13)12(14,15)16/h2-4,10-11,18-19H,5H2,1H3 |
| InChIKey | IGFRDUIBUOHSAZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|