C14H15F3O4S — CID 171876750
S-[4-[2-formyl-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876750) has the molecular formula C14H15F3O4S and a molecular weight of 336.33 g/mol. Its IUPAC name is S-[4-[2-formyl-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-[2-formyl-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876750 |
| Molecular Formula | C14H15F3O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | S-[4-[2-formyl-4-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(C(F)(F)F)cc1C=O |
| InChI | InChI=1S/C14H15F3O4S/c1-8(19)22-5-4-12(20)13(21)11-3-2-10(14(15,16)17)6-9(11)7-18/h2-3,6-7,12-13,20-21H,4-5H2,1H3 |
| InChIKey | YMELCGOHAICYGI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|