C12H14F3NO3 — CID 171882123
2-(4-amino-1,2-dihydroxybutyl)-5-(trifluoromethyl)benzaldehyde (PubChem CID 171882123) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxybutyl)-5-(trifluoromethyl)benzaldehyde.
| Compound Name | 2-(4-amino-1,2-dihydroxybutyl)-5-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 171882123 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-(4-amino-1,2-dihydroxybutyl)-5-(trifluoromethyl)benzaldehyde |
| SMILES | NCCC(O)C(O)c1ccc(C(F)(F)F)cc1C=O |
| InChI | InChI=1S/C12H14F3NO3/c13-12(14,15)8-1-2-9(7(5-8)6-17)11(19)10(18)3-4-16/h1-2,5-6,10-11,18-19H,3-4,16H2 |
| InChIKey | WEHPRNHSTFZPDX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|