C14H16FNO3S — CID 171876297
S-[4-[4-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876297) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is S-[4-[4-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-[4-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876297 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | S-[4-[4-(cyanomethyl)-2-fluorophenyl]-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(CC#N)cc1F |
| InChI | InChI=1S/C14H16FNO3S/c1-9(17)20-7-5-13(18)14(19)11-3-2-10(4-6-16)8-12(11)15/h2-3,8,13-14,18-19H,4-5,7H2,1H3 |
| InChIKey | KKCXPLKTXCUNLV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|