C13H17ClO4S — CID 171875789
S-[4-[2-chloro-5-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875789) has the molecular formula C13H17ClO4S and a molecular weight of 304.80 g/mol. Its IUPAC name is S-[4-[2-chloro-5-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-[2-chloro-5-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875789 |
| Molecular Formula | C13H17ClO4S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | S-[4-[2-chloro-5-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(CO)ccc1Cl |
| InChI | InChI=1S/C13H17ClO4S/c1-8(16)19-5-4-12(17)13(18)10-6-9(7-15)2-3-11(10)14/h2-3,6,12-13,15,17-18H,4-5,7H2,1H3 |
| InChIKey | QGDPPFLZIXRZBR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|