C12H15Cl2NO3S — CID 171875962
S-[4-(4-amino-2,3-dichlorophenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875962) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is S-[4-(4-amino-2,3-dichlorophenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(4-amino-2,3-dichlorophenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875962 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | S-[4-(4-amino-2,3-dichlorophenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(N)c(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-6(16)19-5-4-9(17)12(18)7-2-3-8(15)11(14)10(7)13/h2-3,9,12,17-18H,4-5,15H2,1H3 |
| InChIKey | QPCVAYLTQWRREE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|