C13H16ClFO3S — CID 171875732
S-[4-(4-chloro-2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875732) has the molecular formula C13H16ClFO3S and a molecular weight of 306.79 g/mol. Its IUPAC name is S-[4-(4-chloro-2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(4-chloro-2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875732 |
| Molecular Formula | C13H16ClFO3S |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | S-[4-(4-chloro-2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(C)c(Cl)cc1F |
| InChI | InChI=1S/C13H16ClFO3S/c1-7-5-9(11(15)6-10(7)14)13(18)12(17)3-4-19-8(2)16/h5-6,12-13,17-18H,3-4H2,1-2H3 |
| InChIKey | LSXKKIBCQTWQHL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|