C13H13F2NO3S — CID 171876306
S-[4-(2-cyano-4,5-difluorophenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876306) has the molecular formula C13H13F2NO3S and a molecular weight of 301.31 g/mol. Its IUPAC name is S-[4-(2-cyano-4,5-difluorophenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-cyano-4,5-difluorophenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876306 |
| Molecular Formula | C13H13F2NO3S |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | S-[4-(2-cyano-4,5-difluorophenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(F)c(F)cc1C#N |
| InChI | InChI=1S/C13H13F2NO3S/c1-7(17)20-3-2-12(18)13(19)9-5-11(15)10(14)4-8(9)6-16/h4-5,12-13,18-19H,2-3H2,1H3 |
| InChIKey | YUNYHAIZNDDFCU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|