C12H12F4O3S — CID 171876139
S-[3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butyl] ethanethioate (PubChem CID 171876139) has the molecular formula C12H12F4O3S and a molecular weight of 312.28 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butyl] ethanethioate |
|---|---|
| PubChem CID | 171876139 |
| Molecular Formula | C12H12F4O3S |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | S-[3,4-dihydroxy-4-(2,3,5,6-tetrafluorophenyl)butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H12F4O3S/c1-5(17)20-3-2-8(18)12(19)9-10(15)6(13)4-7(14)11(9)16/h4,8,12,18-19H,2-3H2,1H3 |
| InChIKey | NPQGEFVOVCJQMV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|