C14H17FO4S — CID 171876210
S-[4-(3-acetyl-2-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876210) has the molecular formula C14H17FO4S and a molecular weight of 300.35 g/mol. Its IUPAC name is S-[4-(3-acetyl-2-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(3-acetyl-2-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876210 |
| Molecular Formula | C14H17FO4S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | S-[4-(3-acetyl-2-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cccc(C(C)=O)c1F |
| InChI | InChI=1S/C14H17FO4S/c1-8(16)10-4-3-5-11(13(10)15)14(19)12(18)6-7-20-9(2)17/h3-5,12,14,18-19H,6-7H2,1-2H3 |
| InChIKey | BQTAFNJBDHPKMH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|