C14H19NO4S — CID 171876371
S-[4-(2-acetamidophenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876371) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is S-[4-(2-acetamidophenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-acetamidophenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876371 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | S-[4-(2-acetamidophenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)Nc1ccccc1C(O)C(O)CCSC(C)=O |
| InChI | InChI=1S/C14H19NO4S/c1-9(16)15-12-6-4-3-5-11(12)14(19)13(18)7-8-20-10(2)17/h3-6,13-14,18-19H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | ZWQHMNVEEPZJDE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|