C11H11F3O3S — CID 170821756
S-[2,3-dihydroxy-3-(2,3,4-trifluorophenyl)propyl] ethanethioate (PubChem CID 170821756) has the molecular formula C11H11F3O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(2,3,4-trifluorophenyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(2,3,4-trifluorophenyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170821756 |
| Molecular Formula | C11H11F3O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | S-[2,3-dihydroxy-3-(2,3,4-trifluorophenyl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H11F3O3S/c1-5(15)18-4-8(16)11(17)6-2-3-7(12)10(14)9(6)13/h2-3,8,11,16-17H,4H2,1H3 |
| InChIKey | HZDCYKNCOGTZMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|