C11H14FNO3S — CID 170821645
S-[3-(3-fluoro-6-methyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821645) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is S-[3-(3-fluoro-6-methyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3-fluoro-6-methyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821645 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | S-[3-(3-fluoro-6-methyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1nc(C)ccc1F |
| InChI | InChI=1S/C11H14FNO3S/c1-6-3-4-8(12)10(13-6)11(16)9(15)5-17-7(2)14/h3-4,9,11,15-16H,5H2,1-2H3 |
| InChIKey | DOPYHUKTUBINNG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|