C11H13F2NO3S — CID 170822007
S-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822007) has the molecular formula C11H13F2NO3S and a molecular weight of 277.29 g/mol. Its IUPAC name is S-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822007 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | S-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H13F2NO3S/c1-5(15)18-4-8(16)11(17)9-7(14)3-2-6(12)10(9)13/h2-3,8,11,16-17H,4,14H2,1H3 |
| InChIKey | UNGRARSOTWIDPK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|