C11H14F2N2O3 — CID 170830131
N-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830131) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is N-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830131 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-[3-(6-amino-2,3-difluorophenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H14F2N2O3/c1-5(16)15-4-8(17)11(18)9-7(14)3-2-6(12)10(9)13/h2-3,8,11,17-18H,4,14H2,1H3,(H,15,16) |
| InChIKey | LMCSMORXUOKZOB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|