C12H15FN2O5 — CID 170830723
5-(3-acetamido-1,2-dihydroxypropyl)-2-amino-4-fluorobenzoic acid (PubChem CID 170830723) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is 5-(3-acetamido-1,2-dihydroxypropyl)-2-amino-4-fluorobenzoic acid.
| Compound Name | 5-(3-acetamido-1,2-dihydroxypropyl)-2-amino-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 170830723 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(3-acetamido-1,2-dihydroxypropyl)-2-amino-4-fluorobenzoic acid |
| SMILES | CC(=O)NCC(O)C(O)c1cc(C(=O)O)c(N)cc1F |
| InChI | InChI=1S/C12H15FN2O5/c1-5(16)15-4-10(17)11(18)6-2-7(12(19)20)9(14)3-8(6)13/h2-3,10-11,17-18H,4,14H2,1H3,(H,15,16)(H,19,20) |
| InChIKey | QFBQELNTLKDYEE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|