C12H13FO4S — CID 170821846
S-[3-(2-fluoro-3-formylphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821846) has the molecular formula C12H13FO4S and a molecular weight of 272.30 g/mol. Its IUPAC name is S-[3-(2-fluoro-3-formylphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2-fluoro-3-formylphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821846 |
| Molecular Formula | C12H13FO4S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | S-[3-(2-fluoro-3-formylphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cccc(C=O)c1F |
| InChI | InChI=1S/C12H13FO4S/c1-7(15)18-6-10(16)12(17)9-4-2-3-8(5-14)11(9)13/h2-5,10,12,16-17H,6H2,1H3 |
| InChIKey | YJZDSRCKPAUVAY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|