C11H14O5S — CID 170823224
S-[3-(2,5-dihydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170823224) has the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. Its IUPAC name is S-[3-(2,5-dihydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2,5-dihydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170823224 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | S-[3-(2,5-dihydroxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H14O5S/c1-6(12)17-5-10(15)11(16)8-4-7(13)2-3-9(8)14/h2-4,10-11,13-16H,5H2,1H3 |
| InChIKey | YKHDJHRUDXIVLL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|