C15H19FO4S — CID 170822741
S-[3-[2-(cyclopropylmethoxy)-5-fluorophenyl]-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822741) has the molecular formula C15H19FO4S and a molecular weight of 314.38 g/mol. Its IUPAC name is S-[3-[2-(cyclopropylmethoxy)-5-fluorophenyl]-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-[2-(cyclopropylmethoxy)-5-fluorophenyl]-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822741 |
| Molecular Formula | C15H19FO4S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | S-[3-[2-(cyclopropylmethoxy)-5-fluorophenyl]-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(F)ccc1OCC1CC1 |
| InChI | InChI=1S/C15H19FO4S/c1-9(17)21-8-13(18)15(19)12-6-11(16)4-5-14(12)20-7-10-2-3-10/h4-6,10,13,15,18-19H,2-3,7-8H2,1H3 |
| InChIKey | LJGPBEQUBIWXPQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|