C11H12FNO5S — CID 170822378
S-[3-(5-fluoro-2-nitrophenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822378) has the molecular formula C11H12FNO5S and a molecular weight of 289.28 g/mol. Its IUPAC name is S-[3-(5-fluoro-2-nitrophenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(5-fluoro-2-nitrophenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822378 |
| Molecular Formula | C11H12FNO5S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | S-[3-(5-fluoro-2-nitrophenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12FNO5S/c1-6(14)19-5-10(15)11(16)8-4-7(12)2-3-9(8)13(17)18/h2-4,10-11,15-16H,5H2,1H3 |
| InChIKey | VTQSUXBECGTTNR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|