C11H14N2O6S — CID 170822580
S-[2,3-dihydroxy-3-(6-methoxy-3-nitro-2-pyridinyl)propyl] ethanethioate (PubChem CID 170822580) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(6-methoxy-3-nitro-2-pyridinyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(6-methoxy-3-nitro-2-pyridinyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822580 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | S-[2,3-dihydroxy-3-(6-methoxy-3-nitro-2-pyridinyl)propyl] ethanethioate |
| SMILES | COc1ccc([N+](=O)[O-])c(C(O)C(O)CSC(C)=O)n1 |
| InChI | InChI=1S/C11H14N2O6S/c1-6(14)20-5-8(15)11(16)10-7(13(17)18)3-4-9(12-10)19-2/h3-4,8,11,15-16H,5H2,1-2H3 |
| InChIKey | DJLWRAHAMXWJPW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|