C10H9FN2O4 — CID 171901410
4-(5-fluoro-2-nitrophenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171901410) has the molecular formula C10H9FN2O4 and a molecular weight of 240.19 g/mol. Its IUPAC name is 4-(5-fluoro-2-nitrophenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(5-fluoro-2-nitrophenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901410 |
| Molecular Formula | C10H9FN2O4 |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-(5-fluoro-2-nitrophenyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9FN2O4/c11-6-1-2-8(13(16)17)7(5-6)10(15)9(14)3-4-12/h1-2,5,9-10,14-15H,3H2 |
| InChIKey | QDSBOIBLBKCJNP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|