C9H9ClN4O4 — CID 171901686
4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171901686) has the molecular formula C9H9ClN4O4 and a molecular weight of 272.65 g/mol. Its IUPAC name is 4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901686 |
| Molecular Formula | C9H9ClN4O4 |
| Molecular Weight | 272.65 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cc([N+](=O)[O-])c(N)nc1Cl |
| InChI | InChI=1S/C9H9ClN4O4/c10-8-4(7(16)6(15)1-2-11)3-5(14(17)18)9(12)13-8/h3,6-7,15-16H,1H2,(H2,12,13) |
| InChIKey | OYHIVPYDCNMQGW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.65 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|