C5H3Cl2N3O2 — CID 15392047
5,6-dichloro-3-nitropyridin-2-amine (PubChem CID 15392047) has the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. Its IUPAC name is 5,6-dichloro-3-nitropyridin-2-amine.
| Compound Name | 5,6-dichloro-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 15392047 |
| Molecular Formula | C5H3Cl2N3O2 |
| Molecular Weight | 208.00 g/mol |
| Exact Mass | 206.96 |
| IUPAC Name | 5,6-dichloro-3-nitropyridin-2-amine |
| SMILES | Nc1nc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H3Cl2N3O2/c6-2-1-3(10(11)12)5(8)9-4(2)7/h1H,(H2,8,9) |
| InChIKey | DYSLEQUCBXITJX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.00 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|