C10H6Cl2N4O2S — CID 133324022
2-(3,4-dichlorophenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 133324022) has the molecular formula C10H6Cl2N4O2S and a molecular weight of 317.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | 2-(3,4-dichlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 133324022 |
| Molecular Formula | C10H6Cl2N4O2S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | Nc1nc(Sc2ccc(Cl)c(Cl)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6Cl2N4O2S/c11-6-2-1-5(3-7(6)12)19-10-14-4-8(16(17)18)9(13)15-10/h1-4H,(H2,13,14,15) |
| InChIKey | RLFPPZVOUGEODW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|