C11H12ClN7O2S — CID 122153866
2-[[4-chloro-6-(dimethylamino)pyrimidin-5-yl]methylsulfanyl]-5-nitropyrimidin-4-amine (PubChem CID 122153866) has the molecular formula C11H12ClN7O2S and a molecular weight of 341.78 g/mol. Its IUPAC name is 2-[[4-chloro-6-(dimethylamino)pyrimidin-5-yl]methylsulfanyl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-[[4-chloro-6-(dimethylamino)pyrimidin-5-yl]methylsulfanyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 122153866 |
| Molecular Formula | C11H12ClN7O2S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[[4-chloro-6-(dimethylamino)pyrimidin-5-yl]methylsulfanyl]-5-nitropyrimidin-4-amine |
| SMILES | CN(C)c1ncnc(Cl)c1CSc1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C11H12ClN7O2S/c1-18(2)10-6(8(12)15-5-16-10)4-22-11-14-3-7(19(20)21)9(13)17-11/h3,5H,4H2,1-2H3,(H2,13,14,17) |
| InChIKey | PDKIWJRENBFKKN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|