C8H13N5O2 — CID 71945245
2-N-methyl-5-nitro-2-N-propylpyrimidine-2,4-diamine (PubChem CID 71945245) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-N-methyl-5-nitro-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 2-N-methyl-5-nitro-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71945245 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-N-methyl-5-nitro-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCN(C)c1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C8H13N5O2/c1-3-4-12(2)8-10-5-6(13(14)15)7(9)11-8/h5H,3-4H2,1-2H3,(H2,9,10,11) |
| InChIKey | AWKMHNOGMFYZCG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|