C12H12Cl3N7O6 — CID 159220517
2-chloro-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine;ethyl acetate (PubChem CID 159220517) has the molecular formula C12H12Cl3N7O6 and a molecular weight of 456.63 g/mol. Its IUPAC name is 2-chloro-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine;ethyl acetate.
| Compound Name | 2-chloro-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine;ethyl acetate |
|---|---|
| PubChem CID | 159220517 |
| Molecular Formula | C12H12Cl3N7O6 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | 2-chloro-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine;ethyl acetate |
| SMILES | CCOC(C)=O.Nc1nc(Cl)ncc1[N+](=O)[O-].O=[N+]([O-])c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C4HCl2N3O2.C4H3ClN4O2.C4H8O2/c5-3-2(9(10)11)1-7-4(6)8-3;5-4-7-1-2(9(10)11)3(6)8-4;1-3-6-4(2)5/h1H;1H,(H2,6,7,8);3H2,1-2H3 |
| InChIKey | KRPVOWXYGFGDIC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 190.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|