C12H13ClF2N4O4 — CID 167462930
ethyl 3-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopropylamino]-2,2-difluoropropanoate (PubChem CID 167462930) has the molecular formula C12H13ClF2N4O4 and a molecular weight of 350.71 g/mol. Its IUPAC name is ethyl 3-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopropylamino]-2,2-difluoropropanoate.
| Compound Name | ethyl 3-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopropylamino]-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 167462930 |
| Molecular Formula | C12H13ClF2N4O4 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | ethyl 3-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopropylamino]-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)CN(c1nc(Cl)ncc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C12H13ClF2N4O4/c1-2-23-10(20)12(14,15)6-18(7-3-4-7)9-8(19(21)22)5-16-11(13)17-9/h5,7H,2-4,6H2,1H3 |
| InChIKey | VOAHPOQNXKIOFH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|