C13H17ClN4O4 — CID 175275372
2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclobutylamino]-2-methylbutanoic acid (PubChem CID 175275372) has the molecular formula C13H17ClN4O4 and a molecular weight of 328.76 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclobutylamino]-2-methylbutanoic acid.
| Compound Name | 2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclobutylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 175275372 |
| Molecular Formula | C13H17ClN4O4 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclobutylamino]-2-methylbutanoic acid |
| SMILES | CCC(C)(C(=O)O)N(c1nc(Cl)ncc1[N+](=O)[O-])C1CCC1 |
| InChI | InChI=1S/C13H17ClN4O4/c1-3-13(2,11(19)20)17(8-5-4-6-8)10-9(18(21)22)7-15-12(14)16-10/h7-8H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | DXAQMEPJVWDNJC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|