C12H14ClF3N4O4 — CID 123930875
2-[(2-chloro-5-nitropyrimidin-4-yl)-(3,3,3-trifluoropropyl)amino]-2-methylbutanoic acid (PubChem CID 123930875) has the molecular formula C12H14ClF3N4O4 and a molecular weight of 370.72 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitropyrimidin-4-yl)-(3,3,3-trifluoropropyl)amino]-2-methylbutanoic acid.
| Compound Name | 2-[(2-chloro-5-nitropyrimidin-4-yl)-(3,3,3-trifluoropropyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 123930875 |
| Molecular Formula | C12H14ClF3N4O4 |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-[(2-chloro-5-nitropyrimidin-4-yl)-(3,3,3-trifluoropropyl)amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(C(=O)O)N(CCC(F)(F)F)c1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClF3N4O4/c1-3-11(2,9(21)22)19(5-4-12(14,15)16)8-7(20(23)24)6-17-10(13)18-8/h6H,3-5H2,1-2H3,(H,21,22) |
| InChIKey | NHGWEAZTORTGFH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|