C9H6Cl3N7O4 — CID 158883695
2-chloro-N-methyl-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine (PubChem CID 158883695) has the molecular formula C9H6Cl3N7O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine.
| Compound Name | 2-chloro-N-methyl-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine |
|---|---|
| PubChem CID | 158883695 |
| Molecular Formula | C9H6Cl3N7O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 2-chloro-N-methyl-5-nitropyrimidin-4-amine;2,4-dichloro-5-nitropyrimidine |
| SMILES | CNc1nc(Cl)ncc1[N+](=O)[O-].O=[N+]([O-])c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C5H5ClN4O2.C4HCl2N3O2/c1-7-4-3(10(11)12)2-8-5(6)9-4;5-3-2(9(10)11)1-7-4(6)8-3/h2H,1H3,(H,7,8,9);1H |
| InChIKey | JDIPBVQNHKKNMI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|