C9H12ClN5O3 — CID 114043204
2-[(2-chloro-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide (PubChem CID 114043204) has the molecular formula C9H12ClN5O3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 114043204 |
| Molecular Formula | C9H12ClN5O3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[(2-chloro-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CC(Nc1nc(Cl)ncc1[N+](=O)[O-])C(=O)N(C)C |
| InChI | InChI=1S/C9H12ClN5O3/c1-5(8(16)14(2)3)12-7-6(15(17)18)4-11-9(10)13-7/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | HWNJHABRUSXWBK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|