C9H15N7O3 — CID 80897150
2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide (PubChem CID 80897150) has the molecular formula C9H15N7O3 and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 80897150 |
| Molecular Formula | C9H15N7O3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CC(Nc1ncnc(NN)c1[N+](=O)[O-])C(=O)N(C)C |
| InChI | InChI=1S/C9H15N7O3/c1-5(9(17)15(2)3)13-7-6(16(18)19)8(14-10)12-4-11-7/h4-5H,10H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | NXZMHLRTEVUUHK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|